About 7,9a-dihydro-4H-pyrano[3,2-g]quinoline
7,9a-dihydro-4H-pyrano[3,2-g]quinoline (PubChem CID 57306578) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is 7,9a-dihydro-4H-pyrano[3,2-g]quinoline.
Molecular Properties
| Compound Name | 7,9a-dihydro-4H-pyrano[3,2-g]quinoline |
| PubChem CID | 57306578 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 7,9a-dihydro-4H-pyrano[3,2-g]quinoline |
| SMILES | C1=COC2=CC3N=CCC=C3C=C2C1 |
| InChI | InChI=1S/C12H11NO/c1-3-9-7-10-4-2-6-14-12(10)8-11(9)13-5-1/h2-3,5-8,11H,1,4H2 |
| InChIKey | CMHVOVQDIVVENZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,9a-dihydro-4H-pyrano[3,2-g]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9a-dihydro-4H-pyrano[3,2-g]quinoline?
The IUPAC name of 7,9a-dihydro-4H-pyrano[3,2-g]quinoline (CID 57306578) is 7,9a-dihydro-4H-pyrano[3,2-g]quinoline.
What is the SMILES notation for 7,9a-dihydro-4H-pyrano[3,2-g]quinoline?
The canonical SMILES for 7,9a-dihydro-4H-pyrano[3,2-g]quinoline is C1=COC2=CC3N=CCC=C3C=C2C1.
What is the InChIKey of 7,9a-dihydro-4H-pyrano[3,2-g]quinoline?
The InChIKey is CMHVOVQDIVVENZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO/c1-3-9-7-10-4-2-6-14-12(10)8-11(9)13-5-1/h2-3,5-8,11H,1,4H2.
What are the key properties of 7,9a-dihydro-4H-pyrano[3,2-g]quinoline?
7,9a-dihydro-4H-pyrano[3,2-g]quinoline has a molecular weight of 185.23 g/mol, XLogP of 2.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9a-dihydro-4H-pyrano[3,2-g]quinoline is sourced from PubChem (CID 57306578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).