C19H16Cl2N6 — CID 57306774
1-[2-amino-4-(2,4-dichlorophenyl)imidazol-1-yl]imino-2,3-dihydroindene-4-carboximidamide (PubChem CID 57306774) has the molecular formula C19H16Cl2N6 and a molecular weight of 399.29 g/mol. Its IUPAC name is 1-[2-amino-4-(2,4-dichlorophenyl)imidazol-1-yl]imino-2,3-dihydroindene-4-carboximidamide.
| Compound Name | 1-[2-amino-4-(2,4-dichlorophenyl)imidazol-1-yl]imino-2,3-dihydroindene-4-carboximidamide |
|---|---|
| PubChem CID | 57306774 |
| Molecular Formula | C19H16Cl2N6 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 1-[2-amino-4-(2,4-dichlorophenyl)imidazol-1-yl]imino-2,3-dihydroindene-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccc2c1CCC2=Nn1cc(-c2ccc(Cl)cc2Cl)nc1N |
| InChI | InChI=1S/C19H16Cl2N6/c20-10-4-5-14(15(21)8-10)17-9-27(19(24)25-17)26-16-7-6-11-12(16)2-1-3-13(11)18(22)23/h1-5,8-9H,6-7H2,(H3,22,23)(H2,24,25) |
| InChIKey | GMVKPJYWDYCWCR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|