About 2-chloro-4-(1,1-dihydroxy-1,4-thiazinan-4-yl)benzaldehyde
2-chloro-4-(1,1-dihydroxy-1,4-thiazinan-4-yl)benzaldehyde (PubChem CID 57306859) has the molecular formula C11H14ClNO3S
and a molecular weight of 275.76 g/mol. Its IUPAC name is 2-chloro-4-(1,1-dihydroxy-1,4-thiazinan-4-yl)benzaldehyde.
Molecular Properties
| Compound Name | 2-chloro-4-(1,1-dihydroxy-1,4-thiazinan-4-yl)benzaldehyde |
| PubChem CID | 57306859 |
| Molecular Formula | C11H14ClNO3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 2-chloro-4-(1,1-dihydroxy-1,4-thiazinan-4-yl)benzaldehyde |
| SMILES | O=Cc1ccc(N2CCS(O)(O)CC2)cc1Cl |
| InChI | InChI=1S/C11H14ClNO3S/c12-11-7-10(2-1-9(11)8-14)13-3-5-17(15,16)6-4-13/h1-2,7-8,15-16H,3-6H2 |
| InChIKey | OUWMECHPOHWLTK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-(1,1-dihydroxy-1,4-thiazinan-4-yl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(1,1-dihydroxy-1,4-thiazinan-4-yl)benzaldehyde?
The IUPAC name of 2-chloro-4-(1,1-dihydroxy-1,4-thiazinan-4-yl)benzaldehyde (CID 57306859) is 2-chloro-4-(1,1-dihydroxy-1,4-thiazinan-4-yl)benzaldehyde.
What is the SMILES notation for 2-chloro-4-(1,1-dihydroxy-1,4-thiazinan-4-yl)benzaldehyde?
The canonical SMILES for 2-chloro-4-(1,1-dihydroxy-1,4-thiazinan-4-yl)benzaldehyde is O=Cc1ccc(N2CCS(O)(O)CC2)cc1Cl.
What is the InChIKey of 2-chloro-4-(1,1-dihydroxy-1,4-thiazinan-4-yl)benzaldehyde?
The InChIKey is OUWMECHPOHWLTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO3S/c12-11-7-10(2-1-9(11)8-14)13-3-5-17(15,16)6-4-13/h1-2,7-8,15-16H,3-6H2.
What are the key properties of 2-chloro-4-(1,1-dihydroxy-1,4-thiazinan-4-yl)benzaldehyde?
2-chloro-4-(1,1-dihydroxy-1,4-thiazinan-4-yl)benzaldehyde has a molecular weight of 275.76 g/mol, XLogP of 2.72, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(1,1-dihydroxy-1,4-thiazinan-4-yl)benzaldehyde is sourced from PubChem (CID 57306859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).