C30H33F3O3S — CID 57307016
2,2,2-trifluoro-1-[4-[3-[4-(4-phenyl-1-propylsulfanylbutyl)phenoxy]propoxy]phenyl]ethanone (PubChem CID 57307016) has the molecular formula C30H33F3O3S and a molecular weight of 530.65 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-[3-[4-(4-phenyl-1-propylsulfanylbutyl)phenoxy]propoxy]phenyl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-[3-[4-(4-phenyl-1-propylsulfanylbutyl)phenoxy]propoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 57307016 |
| Molecular Formula | C30H33F3O3S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-[3-[4-(4-phenyl-1-propylsulfanylbutyl)phenoxy]propoxy]phenyl]ethanone |
| SMILES | CCCSC(CCCc1ccccc1)c1ccc(OCCCOc2ccc(C(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H33F3O3S/c1-2-22-37-28(11-6-10-23-8-4-3-5-9-23)24-12-16-26(17-13-24)35-20-7-21-36-27-18-14-25(15-19-27)29(34)30(31,32)33/h3-5,8-9,12-19,28H,2,6-7,10-11,20-22H2,1H3 |
| InChIKey | QNWGDTHCRUYLEM-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|