C18H23NO2 — CID 57307923
11-methyl-2-(3-methylbut-2-enoxymethyl)-3-oxa-11-azatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene (PubChem CID 57307923) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 11-methyl-2-(3-methylbut-2-enoxymethyl)-3-oxa-11-azatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene.
| Compound Name | 11-methyl-2-(3-methylbut-2-enoxymethyl)-3-oxa-11-azatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene |
|---|---|
| PubChem CID | 57307923 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 11-methyl-2-(3-methylbut-2-enoxymethyl)-3-oxa-11-azatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene |
| SMILES | CC(C)=CCOCc1oc2cccc3c2c1CN(C)CC3 |
| InChI | InChI=1S/C18H23NO2/c1-13(2)8-10-20-12-17-15-11-19(3)9-7-14-5-4-6-16(21-17)18(14)15/h4-6,8H,7,9-12H2,1-3H3 |
| InChIKey | IOEKLAQTQWZHBG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|