About 1-dodecyl-3,5-dimethylpyrazole
1-dodecyl-3,5-dimethylpyrazole (PubChem CID 573082) has the molecular formula C17H32N2
and a molecular weight of 264.46 g/mol. Its IUPAC name is 1-dodecyl-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 1-dodecyl-3,5-dimethylpyrazole |
| PubChem CID | 573082 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 1-dodecyl-3,5-dimethylpyrazole |
| SMILES | CCCCCCCCCCCCn1nc(C)cc1C |
| InChI | InChI=1S/C17H32N2/c1-4-5-6-7-8-9-10-11-12-13-14-19-17(3)15-16(2)18-19/h15H,4-14H2,1-3H3 |
| InChIKey | BXYFENZNKPBVNG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-dodecyl-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dodecyl-3,5-dimethylpyrazole?
The IUPAC name of 1-dodecyl-3,5-dimethylpyrazole (CID 573082) is 1-dodecyl-3,5-dimethylpyrazole.
What is the SMILES notation for 1-dodecyl-3,5-dimethylpyrazole?
The canonical SMILES for 1-dodecyl-3,5-dimethylpyrazole is CCCCCCCCCCCCn1nc(C)cc1C.
What is the InChIKey of 1-dodecyl-3,5-dimethylpyrazole?
The InChIKey is BXYFENZNKPBVNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N2/c1-4-5-6-7-8-9-10-11-12-13-14-19-17(3)15-16(2)18-19/h15H,4-14H2,1-3H3.
What are the key properties of 1-dodecyl-3,5-dimethylpyrazole?
1-dodecyl-3,5-dimethylpyrazole has a molecular weight of 264.46 g/mol, XLogP of 5.42, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dodecyl-3,5-dimethylpyrazole is sourced from PubChem (CID 573082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).