C22H42N2 — CID 57308248
1-cyclohexyl-10-pentylundeca-3,7-diene-1,11-diamine (PubChem CID 57308248) has the molecular formula C22H42N2 and a molecular weight of 334.59 g/mol. Its IUPAC name is 1-cyclohexyl-10-pentylundeca-3,7-diene-1,11-diamine.
| Compound Name | 1-cyclohexyl-10-pentylundeca-3,7-diene-1,11-diamine |
|---|---|
| PubChem CID | 57308248 |
| Molecular Formula | C22H42N2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.33 |
| IUPAC Name | 1-cyclohexyl-10-pentylundeca-3,7-diene-1,11-diamine |
| SMILES | CCCCCC(CN)CC=CCCC=CCC(N)C1CCCCC1 |
| InChI | InChI=1S/C22H42N2/c1-2-3-9-14-20(19-23)15-10-6-4-5-7-13-18-22(24)21-16-11-8-12-17-21/h6-7,10,13,20-22H,2-5,8-9,11-12,14-19,23-24H2,1H3 |
| InChIKey | MMCBBMVVFJROEW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|