About 7-chlorohepta-2,4,6-trienylidene(dimethyl)azanium
7-chlorohepta-2,4,6-trienylidene(dimethyl)azanium (PubChem CID 57308280) has the molecular formula C9H13ClN+
and a molecular weight of 170.66 g/mol. Its IUPAC name is 7-chlorohepta-2,4,6-trienylidene(dimethyl)azanium.
Molecular Properties
| Compound Name | 7-chlorohepta-2,4,6-trienylidene(dimethyl)azanium |
| PubChem CID | 57308280 |
| Molecular Formula | C9H13ClN+ |
| Molecular Weight | 170.66 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 7-chlorohepta-2,4,6-trienylidene(dimethyl)azanium |
| SMILES | C[N+](C)=CC=CC=CC=CCl |
| InChI | InChI=1S/C9H13ClN/c1-11(2)9-7-5-3-4-6-8-10/h3-9H,1-2H3/q+1 |
| InChIKey | LMABCVQMNMUURE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.66 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-chlorohepta-2,4,6-trienylidene(dimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chlorohepta-2,4,6-trienylidene(dimethyl)azanium?
The IUPAC name of 7-chlorohepta-2,4,6-trienylidene(dimethyl)azanium (CID 57308280) is 7-chlorohepta-2,4,6-trienylidene(dimethyl)azanium.
What is the SMILES notation for 7-chlorohepta-2,4,6-trienylidene(dimethyl)azanium?
The canonical SMILES for 7-chlorohepta-2,4,6-trienylidene(dimethyl)azanium is C[N+](C)=CC=CC=CC=CCl.
What is the InChIKey of 7-chlorohepta-2,4,6-trienylidene(dimethyl)azanium?
The InChIKey is LMABCVQMNMUURE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN/c1-11(2)9-7-5-3-4-6-8-10/h3-9H,1-2H3/q+1.
What are the key properties of 7-chlorohepta-2,4,6-trienylidene(dimethyl)azanium?
7-chlorohepta-2,4,6-trienylidene(dimethyl)azanium has a molecular weight of 170.66 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chlorohepta-2,4,6-trienylidene(dimethyl)azanium is sourced from PubChem (CID 57308280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).