C9H8Cl2O2 — CID 57308617
2-(3,4-dichlorophenyl)-1,3-dioxolane (PubChem CID 57308617) has the molecular formula C9H8Cl2O2 and a molecular weight of 219.07 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1,3-dioxolane.
| Compound Name | 2-(3,4-dichlorophenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 57308617 |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1,3-dioxolane |
| SMILES | Clc1ccc(C2OCCO2)cc1Cl |
| InChI | InChI=1S/C9H8Cl2O2/c10-7-2-1-6(5-8(7)11)9-12-3-4-13-9/h1-2,5,9H,3-4H2 |
| InChIKey | GTINLBBKOYNKSM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |