C13H20N2 — CID 57309416
N'-(2-methyl-1,4,5,8-tetrahydronaphthalen-1-yl)ethane-1,2-diamine (PubChem CID 57309416) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N'-(2-methyl-1,4,5,8-tetrahydronaphthalen-1-yl)ethane-1,2-diamine.
| Compound Name | N'-(2-methyl-1,4,5,8-tetrahydronaphthalen-1-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 57309416 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N'-(2-methyl-1,4,5,8-tetrahydronaphthalen-1-yl)ethane-1,2-diamine |
| SMILES | CC1=CCC2=C(CC=CC2)C1NCCN |
| InChI | InChI=1S/C13H20N2/c1-10-6-7-11-4-2-3-5-12(11)13(10)15-9-8-14/h2-3,6,13,15H,4-5,7-9,14H2,1H3 |
| InChIKey | BFXNHINRHUEBCN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|