C5H7N5O2 — CID 57309538
2-amino-4,5,7,9-tetrahydro-1H-purine-6,8-dione (PubChem CID 57309538) has the molecular formula C5H7N5O2 and a molecular weight of 169.14 g/mol. Its IUPAC name is 2-amino-4,5,7,9-tetrahydro-1H-purine-6,8-dione.
| Compound Name | 2-amino-4,5,7,9-tetrahydro-1H-purine-6,8-dione |
|---|---|
| PubChem CID | 57309538 |
| Molecular Formula | C5H7N5O2 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 2-amino-4,5,7,9-tetrahydro-1H-purine-6,8-dione |
| SMILES | NC1=NC2NC(=O)NC2C(=O)N1 |
| InChI | InChI=1S/C5H7N5O2/c6-4-8-2-1(3(11)10-4)7-5(12)9-2/h1-2H,(H2,7,9,12)(H3,6,8,10,11) |
| InChIKey | YDVYNNZIKHRGPP-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |