About tert-butyl-[(1S,4S)-6-methoxycarbonyl-4-methylcyclohex-2-en-1-yl]carbamic acid
tert-butyl-[(1S,4S)-6-methoxycarbonyl-4-methylcyclohex-2-en-1-yl]carbamic acid (PubChem CID 57309621) has the molecular formula C14H23NO4
and a molecular weight of 269.34 g/mol. Its IUPAC name is tert-butyl-[(1S,4S)-6-methoxycarbonyl-4-methylcyclohex-2-en-1-yl]carbamic acid.
Molecular Properties
| Compound Name | tert-butyl-[(1S,4S)-6-methoxycarbonyl-4-methylcyclohex-2-en-1-yl]carbamic acid |
| PubChem CID | 57309621 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | tert-butyl-[(1S,4S)-6-methoxycarbonyl-4-methylcyclohex-2-en-1-yl]carbamic acid |
| SMILES | COC(=O)C1C[C@H](C)C=C[C@@H]1N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C14H23NO4/c1-9-6-7-11(10(8-9)12(16)19-5)15(13(17)18)14(2,3)4/h6-7,9-11H,8H2,1-5H3,(H,17,18)/t9-,10?,11+/m1/s1 |
| InChIKey | SQYBFYSPCLRYFF-FBKFWFMHSA-N |
| XLogP | 2.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(1S,4S)-6-methoxycarbonyl-4-methylcyclohex-2-en-1-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(1S,4S)-6-methoxycarbonyl-4-methylcyclohex-2-en-1-yl]carbamic acid?
The IUPAC name of tert-butyl-[(1S,4S)-6-methoxycarbonyl-4-methylcyclohex-2-en-1-yl]carbamic acid (CID 57309621) is tert-butyl-[(1S,4S)-6-methoxycarbonyl-4-methylcyclohex-2-en-1-yl]carbamic acid.
What is the SMILES notation for tert-butyl-[(1S,4S)-6-methoxycarbonyl-4-methylcyclohex-2-en-1-yl]carbamic acid?
The canonical SMILES for tert-butyl-[(1S,4S)-6-methoxycarbonyl-4-methylcyclohex-2-en-1-yl]carbamic acid is COC(=O)C1C[C@H](C)C=C[C@@H]1N(C(=O)O)C(C)(C)C.
What is the InChIKey of tert-butyl-[(1S,4S)-6-methoxycarbonyl-4-methylcyclohex-2-en-1-yl]carbamic acid?
The InChIKey is SQYBFYSPCLRYFF-FBKFWFMHSA-N. The full InChI is InChI=1S/C14H23NO4/c1-9-6-7-11(10(8-9)12(16)19-5)15(13(17)18)14(2,3)4/h6-7,9-11H,8H2,1-5H3,(H,17,18)/t9-,10?,11+/m1/s1.
What are the key properties of tert-butyl-[(1S,4S)-6-methoxycarbonyl-4-methylcyclohex-2-en-1-yl]carbamic acid?
tert-butyl-[(1S,4S)-6-methoxycarbonyl-4-methylcyclohex-2-en-1-yl]carbamic acid has a molecular weight of 269.34 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(1S,4S)-6-methoxycarbonyl-4-methylcyclohex-2-en-1-yl]carbamic acid is sourced from PubChem (CID 57309621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).