C28H37N3O2 — CID 57309710
1-N,3-N-bis(1-adamantyl)-5-aminobenzene-1,3-dicarboxamide (PubChem CID 57309710) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is 1-N,3-N-bis(1-adamantyl)-5-aminobenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(1-adamantyl)-5-aminobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 57309710 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | 1-N,3-N-bis(1-adamantyl)-5-aminobenzene-1,3-dicarboxamide |
| SMILES | Nc1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)cc(C(=O)NC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C28H37N3O2/c29-24-8-22(25(32)30-27-10-16-1-17(11-27)3-18(2-16)12-27)7-23(9-24)26(33)31-28-13-19-4-20(14-28)6-21(5-19)15-28/h7-9,16-21H,1-6,10-15,29H2,(H,30,32)(H,31,33) |
| InChIKey | YHVXMEVWFRLWBC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|