(2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid

C6H15N5O2 — CID 57310016

IUPAC(2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid
SMILESNC(N)=NCC(N)C[C@@H](N)C(=O)O
InChIInChI=1S/C6H15N5O2/c7-3(2-11-6(9)10)1-4(8)5(12)13/h3-4H,1-2,7-8H2,(H,12,13)(H4,9,10,11)/t3?,4-/m1/s1
InChIKeyQKEMZCKQBSVHDC-SRBOSORUSA-N
MW189.22 g/mol
LogP-2.61
Rot. Bonds5

About (2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid

(2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 57310016) has the molecular formula C6H15N5O2 and a molecular weight of 189.22 g/mol. Its IUPAC name is (2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid.

Molecular Properties

Compound Name(2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid
PubChem CID57310016
Molecular FormulaC6H15N5O2
Molecular Weight189.22 g/mol
Exact Mass189.12
IUPAC Name(2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid
SMILESNC(N)=NCC(N)C[C@@H](N)C(=O)O
InChIInChI=1S/C6H15N5O2/c7-3(2-11-6(9)10)1-4(8)5(12)13/h3-4H,1-2,7-8H2,(H,12,13)(H4,9,10,11)/t3?,4-/m1/s1
InChIKeyQKEMZCKQBSVHDC-SRBOSORUSA-N
XLogP-2.61
TPSA153.74 Ų
H-Bond Donors5
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.22
LogP ≤ 5-2.61
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze (2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid?
The IUPAC name of (2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid (CID 57310016) is (2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid.
What is the SMILES notation for (2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid?
The canonical SMILES for (2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid is NC(N)=NCC(N)C[C@@H](N)C(=O)O.
What is the InChIKey of (2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid?
The InChIKey is QKEMZCKQBSVHDC-SRBOSORUSA-N. The full InChI is InChI=1S/C6H15N5O2/c7-3(2-11-6(9)10)1-4(8)5(12)13/h3-4H,1-2,7-8H2,(H,12,13)(H4,9,10,11)/t3?,4-/m1/s1.
What are the key properties of (2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid?
(2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid has a molecular weight of 189.22 g/mol, XLogP of -2.61, 5 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,4-diamino-5-(diaminomethylideneamino)pentanoic acid is sourced from PubChem (CID 57310016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).