C31H39F3N2O2 — CID 57310154
(3aS,3bS,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-N-[1-[3-(trifluoromethyl)phenyl]cyclopentyl]-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide (PubChem CID 57310154) has the molecular formula C31H39F3N2O2 and a molecular weight of 528.66 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-N-[1-[3-(trifluoromethyl)phenyl]cyclopentyl]-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide.
| Compound Name | (3aS,3bS,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-N-[1-[3-(trifluoromethyl)phenyl]cyclopentyl]-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide |
|---|---|
| PubChem CID | 57310154 |
| Molecular Formula | C31H39F3N2O2 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | (3aS,3bS,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-N-[1-[3-(trifluoromethyl)phenyl]cyclopentyl]-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide |
| SMILES | C[C@]12C=CC(=O)NC1CC[C@@H]1[C@H]2CC[C@]2(C)C(C(=O)NC3(c4cccc(C(F)(F)F)c4)CCCC3)CC[C@@H]12 |
| InChI | InChI=1S/C31H39F3N2O2/c1-28-16-12-23-21(8-11-25-29(23,2)17-13-26(37)35-25)22(28)9-10-24(28)27(38)36-30(14-3-4-15-30)19-6-5-7-20(18-19)31(32,33)34/h5-7,13,17-18,21-25H,3-4,8-12,14-16H2,1-2H3,(H,35,37)(H,36,38)/t21-,22-,23+,24?,25?,28-,29+/m0/s1 |
| InChIKey | RGXGLWIZBOHDER-CRHCYFAASA-N |
| XLogP | 6.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |