About 2-[(4-methylphenyl)methyl]-2-(1H-pyrrol-2-yl)butane-1,4-diol
2-[(4-methylphenyl)methyl]-2-(1H-pyrrol-2-yl)butane-1,4-diol (PubChem CID 57310289) has the molecular formula C16H21NO2
and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methyl]-2-(1H-pyrrol-2-yl)butane-1,4-diol.
Molecular Properties
| Compound Name | 2-[(4-methylphenyl)methyl]-2-(1H-pyrrol-2-yl)butane-1,4-diol |
| PubChem CID | 57310289 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 2-[(4-methylphenyl)methyl]-2-(1H-pyrrol-2-yl)butane-1,4-diol |
| SMILES | Cc1ccc(CC(CO)(CCO)c2ccc[nH]2)cc1 |
| InChI | InChI=1S/C16H21NO2/c1-13-4-6-14(7-5-13)11-16(12-19,8-10-18)15-3-2-9-17-15/h2-7,9,17-19H,8,10-12H2,1H3 |
| InChIKey | PTYOTNWKZWAZIA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(4-methylphenyl)methyl]-2-(1H-pyrrol-2-yl)butane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methylphenyl)methyl]-2-(1H-pyrrol-2-yl)butane-1,4-diol?
The IUPAC name of 2-[(4-methylphenyl)methyl]-2-(1H-pyrrol-2-yl)butane-1,4-diol (CID 57310289) is 2-[(4-methylphenyl)methyl]-2-(1H-pyrrol-2-yl)butane-1,4-diol.
What is the SMILES notation for 2-[(4-methylphenyl)methyl]-2-(1H-pyrrol-2-yl)butane-1,4-diol?
The canonical SMILES for 2-[(4-methylphenyl)methyl]-2-(1H-pyrrol-2-yl)butane-1,4-diol is Cc1ccc(CC(CO)(CCO)c2ccc[nH]2)cc1.
What is the InChIKey of 2-[(4-methylphenyl)methyl]-2-(1H-pyrrol-2-yl)butane-1,4-diol?
The InChIKey is PTYOTNWKZWAZIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO2/c1-13-4-6-14(7-5-13)11-16(12-19,8-10-18)15-3-2-9-17-15/h2-7,9,17-19H,8,10-12H2,1H3.
What are the key properties of 2-[(4-methylphenyl)methyl]-2-(1H-pyrrol-2-yl)butane-1,4-diol?
2-[(4-methylphenyl)methyl]-2-(1H-pyrrol-2-yl)butane-1,4-diol has a molecular weight of 259.35 g/mol, XLogP of 2.18, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methylphenyl)methyl]-2-(1H-pyrrol-2-yl)butane-1,4-diol is sourced from PubChem (CID 57310289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).