About 3-methoxy-1,2,4a,8a-tetrahydronaphthalene
3-methoxy-1,2,4a,8a-tetrahydronaphthalene (PubChem CID 57310354) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 3-methoxy-1,2,4a,8a-tetrahydronaphthalene.
Molecular Properties
| Compound Name | 3-methoxy-1,2,4a,8a-tetrahydronaphthalene |
| PubChem CID | 57310354 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 3-methoxy-1,2,4a,8a-tetrahydronaphthalene |
| SMILES | COC1=CC2C=CC=CC2CC1 |
| InChI | InChI=1S/C11H14O/c1-12-11-7-6-9-4-2-3-5-10(9)8-11/h2-5,8-10H,6-7H2,1H3 |
| InChIKey | NHAMVHAMDLVHDE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methoxy-1,2,4a,8a-tetrahydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-1,2,4a,8a-tetrahydronaphthalene?
The IUPAC name of 3-methoxy-1,2,4a,8a-tetrahydronaphthalene (CID 57310354) is 3-methoxy-1,2,4a,8a-tetrahydronaphthalene.
What is the SMILES notation for 3-methoxy-1,2,4a,8a-tetrahydronaphthalene?
The canonical SMILES for 3-methoxy-1,2,4a,8a-tetrahydronaphthalene is COC1=CC2C=CC=CC2CC1.
What is the InChIKey of 3-methoxy-1,2,4a,8a-tetrahydronaphthalene?
The InChIKey is NHAMVHAMDLVHDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-12-11-7-6-9-4-2-3-5-10(9)8-11/h2-5,8-10H,6-7H2,1H3.
What are the key properties of 3-methoxy-1,2,4a,8a-tetrahydronaphthalene?
3-methoxy-1,2,4a,8a-tetrahydronaphthalene has a molecular weight of 162.23 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-1,2,4a,8a-tetrahydronaphthalene is sourced from PubChem (CID 57310354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).