C24H34S2 — CID 57310656
2-[(2,6-diethyl-3,4-dimethylphenyl)disulfanyl]-1,3-diethyl-4,5-dimethylbenzene (PubChem CID 57310656) has the molecular formula C24H34S2 and a molecular weight of 386.67 g/mol. Its IUPAC name is 2-[(2,6-diethyl-3,4-dimethylphenyl)disulfanyl]-1,3-diethyl-4,5-dimethylbenzene.
| Compound Name | 2-[(2,6-diethyl-3,4-dimethylphenyl)disulfanyl]-1,3-diethyl-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 57310656 |
| Molecular Formula | C24H34S2 |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-[(2,6-diethyl-3,4-dimethylphenyl)disulfanyl]-1,3-diethyl-4,5-dimethylbenzene |
| SMILES | CCc1cc(C)c(C)c(CC)c1SSc1c(CC)cc(C)c(C)c1CC |
| InChI | InChI=1S/C24H34S2/c1-9-19-13-15(5)17(7)21(11-3)23(19)25-26-24-20(10-2)14-16(6)18(8)22(24)12-4/h13-14H,9-12H2,1-8H3 |
| InChIKey | LLAPJCAZDFWUJW-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|