About 2-dodecyliminopropanoic acid
2-dodecyliminopropanoic acid (PubChem CID 57310763) has the molecular formula C15H29NO2
and a molecular weight of 255.40 g/mol. Its IUPAC name is 2-dodecyliminopropanoic acid.
Molecular Properties
| Compound Name | 2-dodecyliminopropanoic acid |
| PubChem CID | 57310763 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 2-dodecyliminopropanoic acid |
| SMILES | CCCCCCCCCCCC/N=C(\C)C(=O)O |
| InChI | InChI=1S/C15H29NO2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15(17)18/h3-13H2,1-2H3,(H,17,18)/b16-14+ |
| InChIKey | TYEUGZVRDRRWRZ-JQIJEIRASA-N |
| XLogP | 4.45 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-dodecyliminopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dodecyliminopropanoic acid?
The IUPAC name of 2-dodecyliminopropanoic acid (CID 57310763) is 2-dodecyliminopropanoic acid.
What is the SMILES notation for 2-dodecyliminopropanoic acid?
The canonical SMILES for 2-dodecyliminopropanoic acid is CCCCCCCCCCCC/N=C(\C)C(=O)O.
What is the InChIKey of 2-dodecyliminopropanoic acid?
The InChIKey is TYEUGZVRDRRWRZ-JQIJEIRASA-N. The full InChI is InChI=1S/C15H29NO2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15(17)18/h3-13H2,1-2H3,(H,17,18)/b16-14+.
What are the key properties of 2-dodecyliminopropanoic acid?
2-dodecyliminopropanoic acid has a molecular weight of 255.40 g/mol, XLogP of 4.45, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dodecyliminopropanoic acid is sourced from PubChem (CID 57310763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).