C15H25Cl2N5O — CID 57310769
3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-1-(2,2,6,6-tetramethylpiperidin-4-yl)propan-1-ol (PubChem CID 57310769) has the molecular formula C15H25Cl2N5O and a molecular weight of 362.31 g/mol. Its IUPAC name is 3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-1-(2,2,6,6-tetramethylpiperidin-4-yl)propan-1-ol.
| Compound Name | 3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-1-(2,2,6,6-tetramethylpiperidin-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 57310769 |
| Molecular Formula | C15H25Cl2N5O |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-1-(2,2,6,6-tetramethylpiperidin-4-yl)propan-1-ol |
| SMILES | CC1(C)CC(C(O)CCNc2nc(Cl)nc(Cl)n2)CC(C)(C)N1 |
| InChI | InChI=1S/C15H25Cl2N5O/c1-14(2)7-9(8-15(3,4)22-14)10(23)5-6-18-13-20-11(16)19-12(17)21-13/h9-10,22-23H,5-8H2,1-4H3,(H,18,19,20,21) |
| InChIKey | BBPTWMWZDJHSCA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |