C22H26F3NO4Si — CID 57311188
benzyl (4S,5S)-4-benzyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate (PubChem CID 57311188) has the molecular formula C22H26F3NO4Si and a molecular weight of 453.53 g/mol. Its IUPAC name is benzyl (4S,5S)-4-benzyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (4S,5S)-4-benzyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 57311188 |
| Molecular Formula | C22H26F3NO4Si |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | benzyl (4S,5S)-4-benzyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate |
| SMILES | C[Si](C)(C)O[C@@]1(C(F)(F)F)OCN(C(=O)OCc2ccccc2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C22H26F3NO4Si/c1-31(2,3)30-21(22(23,24)25)19(14-17-10-6-4-7-11-17)26(16-29-21)20(27)28-15-18-12-8-5-9-13-18/h4-13,19H,14-16H2,1-3H3/t19-,21-/m0/s1 |
| InChIKey | SYNYTHBYTFFYST-FPOVZHCZSA-N |
| XLogP | 5.33 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|