About 2-(4-piperazin-1-ylbutyl)-1,3-thiazolidine
2-(4-piperazin-1-ylbutyl)-1,3-thiazolidine (PubChem CID 57311362) has the molecular formula C11H23N3S
and a molecular weight of 229.39 g/mol. Its IUPAC name is 2-(4-piperazin-1-ylbutyl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-(4-piperazin-1-ylbutyl)-1,3-thiazolidine |
| PubChem CID | 57311362 |
| Molecular Formula | C11H23N3S |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 2-(4-piperazin-1-ylbutyl)-1,3-thiazolidine |
| SMILES | C(CCN1CCNCC1)CC1NCCS1 |
| InChI | InChI=1S/C11H23N3S/c1(3-11-13-6-10-15-11)2-7-14-8-4-12-5-9-14/h11-13H,1-10H2 |
| InChIKey | RSFYJKXDYCMCCU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-piperazin-1-ylbutyl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-piperazin-1-ylbutyl)-1,3-thiazolidine?
The IUPAC name of 2-(4-piperazin-1-ylbutyl)-1,3-thiazolidine (CID 57311362) is 2-(4-piperazin-1-ylbutyl)-1,3-thiazolidine.
What is the SMILES notation for 2-(4-piperazin-1-ylbutyl)-1,3-thiazolidine?
The canonical SMILES for 2-(4-piperazin-1-ylbutyl)-1,3-thiazolidine is C(CCN1CCNCC1)CC1NCCS1.
What is the InChIKey of 2-(4-piperazin-1-ylbutyl)-1,3-thiazolidine?
The InChIKey is RSFYJKXDYCMCCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3S/c1(3-11-13-6-10-15-11)2-7-14-8-4-12-5-9-14/h11-13H,1-10H2.
What are the key properties of 2-(4-piperazin-1-ylbutyl)-1,3-thiazolidine?
2-(4-piperazin-1-ylbutyl)-1,3-thiazolidine has a molecular weight of 229.39 g/mol, XLogP of 0.72, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-piperazin-1-ylbutyl)-1,3-thiazolidine is sourced from PubChem (CID 57311362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).