About 1-(5,5-dimethylhex-2-enoxy)-5,5-dimethylhex-2-ene
1-(5,5-dimethylhex-2-enoxy)-5,5-dimethylhex-2-ene (PubChem CID 57311767) has the molecular formula C16H30O
and a molecular weight of 238.41 g/mol. Its IUPAC name is 1-(5,5-dimethylhex-2-enoxy)-5,5-dimethylhex-2-ene.
Molecular Properties
| Compound Name | 1-(5,5-dimethylhex-2-enoxy)-5,5-dimethylhex-2-ene |
| PubChem CID | 57311767 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 1-(5,5-dimethylhex-2-enoxy)-5,5-dimethylhex-2-ene |
| SMILES | CC(C)(C)CC=CCOCC=CCC(C)(C)C |
| InChI | InChI=1S/C16H30O/c1-15(2,3)11-7-9-13-17-14-10-8-12-16(4,5)6/h7-10H,11-14H2,1-6H3 |
| InChIKey | SIPSSSUBRXHQAP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(5,5-dimethylhex-2-enoxy)-5,5-dimethylhex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,5-dimethylhex-2-enoxy)-5,5-dimethylhex-2-ene?
The IUPAC name of 1-(5,5-dimethylhex-2-enoxy)-5,5-dimethylhex-2-ene (CID 57311767) is 1-(5,5-dimethylhex-2-enoxy)-5,5-dimethylhex-2-ene.
What is the SMILES notation for 1-(5,5-dimethylhex-2-enoxy)-5,5-dimethylhex-2-ene?
The canonical SMILES for 1-(5,5-dimethylhex-2-enoxy)-5,5-dimethylhex-2-ene is CC(C)(C)CC=CCOCC=CCC(C)(C)C.
What is the InChIKey of 1-(5,5-dimethylhex-2-enoxy)-5,5-dimethylhex-2-ene?
The InChIKey is SIPSSSUBRXHQAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O/c1-15(2,3)11-7-9-13-17-14-10-8-12-16(4,5)6/h7-10H,11-14H2,1-6H3.
What are the key properties of 1-(5,5-dimethylhex-2-enoxy)-5,5-dimethylhex-2-ene?
1-(5,5-dimethylhex-2-enoxy)-5,5-dimethylhex-2-ene has a molecular weight of 238.41 g/mol, XLogP of 4.99, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,5-dimethylhex-2-enoxy)-5,5-dimethylhex-2-ene is sourced from PubChem (CID 57311767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).