C20H38N2 — CID 57312050
N,N',N'-tricyclohexylethane-1,2-diamine (PubChem CID 57312050) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is N,N',N'-tricyclohexylethane-1,2-diamine.
| Compound Name | N,N',N'-tricyclohexylethane-1,2-diamine |
|---|---|
| PubChem CID | 57312050 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | N,N',N'-tricyclohexylethane-1,2-diamine |
| SMILES | C1CCC(NCCN(C2CCCCC2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H38N2/c1-4-10-18(11-5-1)21-16-17-22(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h18-21H,1-17H2 |
| InChIKey | RRKYFSZRSINYME-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |