About 3-methylbutan-2-yl sulfite
3-methylbutan-2-yl sulfite (PubChem CID 57312381) has the molecular formula C5H11O3S-
and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-methylbutan-2-yl sulfite.
Molecular Properties
| Compound Name | 3-methylbutan-2-yl sulfite |
| PubChem CID | 57312381 |
| Molecular Formula | C5H11O3S- |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 3-methylbutan-2-yl sulfite |
| SMILES | CC(C)C(C)OS(=O)[O-] |
| InChI | InChI=1S/C5H12O3S/c1-4(2)5(3)8-9(6)7/h4-5H,1-3H3,(H,6,7)/p-1 |
| InChIKey | IPEOTDJVNQWKOP-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutan-2-yl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-2-yl sulfite?
The IUPAC name of 3-methylbutan-2-yl sulfite (CID 57312381) is 3-methylbutan-2-yl sulfite.
What is the SMILES notation for 3-methylbutan-2-yl sulfite?
The canonical SMILES for 3-methylbutan-2-yl sulfite is CC(C)C(C)OS(=O)[O-].
What is the InChIKey of 3-methylbutan-2-yl sulfite?
The InChIKey is IPEOTDJVNQWKOP-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H12O3S/c1-4(2)5(3)8-9(6)7/h4-5H,1-3H3,(H,6,7)/p-1.
What are the key properties of 3-methylbutan-2-yl sulfite?
3-methylbutan-2-yl sulfite has a molecular weight of 151.21 g/mol, XLogP of 0.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-2-yl sulfite is sourced from PubChem (CID 57312381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).