C35H45N5O4 — CID 57312415
4-[[2-amino-3-[2-oxo-2-(N,2,6-trimethylanilino)ethyl]-4H-quinazolin-6-yl]oxy]-N-(6-hydroxyhexyl)-N-phenylbutanamide (PubChem CID 57312415) has the molecular formula C35H45N5O4 and a molecular weight of 599.78 g/mol. Its IUPAC name is 4-[[2-amino-3-[2-oxo-2-(N,2,6-trimethylanilino)ethyl]-4H-quinazolin-6-yl]oxy]-N-(6-hydroxyhexyl)-N-phenylbutanamide.
| Compound Name | 4-[[2-amino-3-[2-oxo-2-(N,2,6-trimethylanilino)ethyl]-4H-quinazolin-6-yl]oxy]-N-(6-hydroxyhexyl)-N-phenylbutanamide |
|---|---|
| PubChem CID | 57312415 |
| Molecular Formula | C35H45N5O4 |
| Molecular Weight | 599.78 g/mol |
| Exact Mass | 599.35 |
| IUPAC Name | 4-[[2-amino-3-[2-oxo-2-(N,2,6-trimethylanilino)ethyl]-4H-quinazolin-6-yl]oxy]-N-(6-hydroxyhexyl)-N-phenylbutanamide |
| SMILES | Cc1cccc(C)c1N(C)C(=O)CN1Cc2cc(OCCCC(=O)N(CCCCCCO)c3ccccc3)ccc2N=C1N |
| InChI | InChI=1S/C35H45N5O4/c1-26-13-11-14-27(2)34(26)38(3)33(43)25-39-24-28-23-30(18-19-31(28)37-35(39)36)44-22-12-17-32(42)40(20-9-4-5-10-21-41)29-15-7-6-8-16-29/h6-8,11,13-16,18-19,23,41H,4-5,9-10,12,17,20-22,24-25H2,1-3H3,(H2,36,37) |
| InChIKey | TYDYYHPIUMNKLG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 111.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.78 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|