About (2,2-dimethyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitronaphthalen-1-yl)diazene
(2,2-dimethyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitronaphthalen-1-yl)diazene (PubChem CID 57312768) has the molecular formula C24H20N4O2
and a molecular weight of 396.45 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitronaphthalen-1-yl)diazene.
Molecular Properties
| Compound Name | (2,2-dimethyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitronaphthalen-1-yl)diazene |
| PubChem CID | 57312768 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (2,2-dimethyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitronaphthalen-1-yl)diazene |
| SMILES | CC1(C)Cc2ccc(/N=N/c3ccc([N+](=O)[O-])c4ccccc34)c3cccc(c23)N1 |
| InChI | InChI=1S/C24H20N4O2/c1-24(2)14-15-10-11-20(18-8-5-9-21(25-24)23(15)18)27-26-19-12-13-22(28(29)30)17-7-4-3-6-16(17)19/h3-13,25H,14H2,1-2H3/b27-26+ |
| InChIKey | QPDXKGLOUQZQJF-CYYJNZCTSA-N |
| XLogP | 7.06 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitronaphthalen-1-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitronaphthalen-1-yl)diazene?
The IUPAC name of (2,2-dimethyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitronaphthalen-1-yl)diazene (CID 57312768) is (2,2-dimethyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitronaphthalen-1-yl)diazene.
What is the SMILES notation for (2,2-dimethyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitronaphthalen-1-yl)diazene?
The canonical SMILES for (2,2-dimethyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitronaphthalen-1-yl)diazene is CC1(C)Cc2ccc(/N=N/c3ccc([N+](=O)[O-])c4ccccc34)c3cccc(c23)N1.
What is the InChIKey of (2,2-dimethyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitronaphthalen-1-yl)diazene?
The InChIKey is QPDXKGLOUQZQJF-CYYJNZCTSA-N. The full InChI is InChI=1S/C24H20N4O2/c1-24(2)14-15-10-11-20(18-8-5-9-21(25-24)23(15)18)27-26-19-12-13-22(28(29)30)17-7-4-3-6-16(17)19/h3-13,25H,14H2,1-2H3/b27-26+.
What are the key properties of (2,2-dimethyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitronaphthalen-1-yl)diazene?
(2,2-dimethyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitronaphthalen-1-yl)diazene has a molecular weight of 396.45 g/mol, XLogP of 7.06, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitronaphthalen-1-yl)diazene is sourced from PubChem (CID 57312768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).