C11H11F3N2O3S — CID 57312856
5-[1-[4-(trifluoromethoxy)phenoxy]ethylsulfanyl]-2,3-dihydro-1,3,4-oxadiazole (PubChem CID 57312856) has the molecular formula C11H11F3N2O3S and a molecular weight of 308.28 g/mol. Its IUPAC name is 5-[1-[4-(trifluoromethoxy)phenoxy]ethylsulfanyl]-2,3-dihydro-1,3,4-oxadiazole.
| Compound Name | 5-[1-[4-(trifluoromethoxy)phenoxy]ethylsulfanyl]-2,3-dihydro-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 57312856 |
| Molecular Formula | C11H11F3N2O3S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 5-[1-[4-(trifluoromethoxy)phenoxy]ethylsulfanyl]-2,3-dihydro-1,3,4-oxadiazole |
| SMILES | CC(Oc1ccc(OC(F)(F)F)cc1)SC1=NNCO1 |
| InChI | InChI=1S/C11H11F3N2O3S/c1-7(20-10-16-15-6-17-10)18-8-2-4-9(5-3-8)19-11(12,13)14/h2-5,7,15H,6H2,1H3 |
| InChIKey | NVOKQOSKOUXTKU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|