About 3-[(2,6-difluorophenyl)methyl]triazol-4-amine
3-[(2,6-difluorophenyl)methyl]triazol-4-amine (PubChem CID 57313220) has the molecular formula C9H8F2N4
and a molecular weight of 210.19 g/mol. Its IUPAC name is 3-[(2,6-difluorophenyl)methyl]triazol-4-amine.
Molecular Properties
| Compound Name | 3-[(2,6-difluorophenyl)methyl]triazol-4-amine |
| PubChem CID | 57313220 |
| Molecular Formula | C9H8F2N4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 3-[(2,6-difluorophenyl)methyl]triazol-4-amine |
| SMILES | Nc1cnnn1Cc1c(F)cccc1F |
| InChI | InChI=1S/C9H8F2N4/c10-7-2-1-3-8(11)6(7)5-15-9(12)4-13-14-15/h1-4H,5,12H2 |
| InChIKey | DMGPWOUADAPPJM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2,6-difluorophenyl)methyl]triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-difluorophenyl)methyl]triazol-4-amine?
The IUPAC name of 3-[(2,6-difluorophenyl)methyl]triazol-4-amine (CID 57313220) is 3-[(2,6-difluorophenyl)methyl]triazol-4-amine.
What is the SMILES notation for 3-[(2,6-difluorophenyl)methyl]triazol-4-amine?
The canonical SMILES for 3-[(2,6-difluorophenyl)methyl]triazol-4-amine is Nc1cnnn1Cc1c(F)cccc1F.
What is the InChIKey of 3-[(2,6-difluorophenyl)methyl]triazol-4-amine?
The InChIKey is DMGPWOUADAPPJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2N4/c10-7-2-1-3-8(11)6(7)5-15-9(12)4-13-14-15/h1-4H,5,12H2.
What are the key properties of 3-[(2,6-difluorophenyl)methyl]triazol-4-amine?
3-[(2,6-difluorophenyl)methyl]triazol-4-amine has a molecular weight of 210.19 g/mol, XLogP of 1.19, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-difluorophenyl)methyl]triazol-4-amine is sourced from PubChem (CID 57313220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).