C26H32N2O4Si — CID 57313403
1-[(2R,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 57313403) has the molecular formula C26H32N2O4Si and a molecular weight of 464.64 g/mol. Its IUPAC name is 1-[(2R,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57313403 |
| Molecular Formula | C26H32N2O4Si |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 1-[(2R,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2CC(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H32N2O4Si/c1-18-17-28(25(30)27-24(18)29)23-16-22(19(2)31-23)32-33(26(3,4)5,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,17,19,22-23H,16H2,1-5H3,(H,27,29,30)/t19-,22?,23-/m1/s1 |
| InChIKey | CRBKXBIDKBZMMW-QQHBYLCDSA-N |
| XLogP | 3.10 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|