C11H12BrN5O — CID 57313421
5-(2-bromoethoxy)-4-(1,3,5-triazin-2-yl)benzene-1,3-diamine (PubChem CID 57313421) has the molecular formula C11H12BrN5O and a molecular weight of 310.16 g/mol. Its IUPAC name is 5-(2-bromoethoxy)-4-(1,3,5-triazin-2-yl)benzene-1,3-diamine.
| Compound Name | 5-(2-bromoethoxy)-4-(1,3,5-triazin-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 57313421 |
| Molecular Formula | C11H12BrN5O |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 5-(2-bromoethoxy)-4-(1,3,5-triazin-2-yl)benzene-1,3-diamine |
| SMILES | Nc1cc(N)c(-c2ncncn2)c(OCCBr)c1 |
| InChI | InChI=1S/C11H12BrN5O/c12-1-2-18-9-4-7(13)3-8(14)10(9)11-16-5-15-6-17-11/h3-6H,1-2,13-14H2 |
| InChIKey | AWGMFMUJMOPFCF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|