C18H22F2N4O3 — CID 57313451
2-[(3,4-difluoroanilino)methyl]-1-methyl-1-(3,4,5-trimethoxyphenyl)guanidine (PubChem CID 57313451) has the molecular formula C18H22F2N4O3 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-[(3,4-difluoroanilino)methyl]-1-methyl-1-(3,4,5-trimethoxyphenyl)guanidine.
| Compound Name | 2-[(3,4-difluoroanilino)methyl]-1-methyl-1-(3,4,5-trimethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 57313451 |
| Molecular Formula | C18H22F2N4O3 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-[(3,4-difluoroanilino)methyl]-1-methyl-1-(3,4,5-trimethoxyphenyl)guanidine |
| SMILES | COc1cc(N(C)C(N)=NCNc2ccc(F)c(F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C18H22F2N4O3/c1-24(12-8-15(25-2)17(27-4)16(9-12)26-3)18(21)23-10-22-11-5-6-13(19)14(20)7-11/h5-9,22H,10H2,1-4H3,(H2,21,23) |
| InChIKey | KKYSETMEQIWIHQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|