About 7aH-benzo[a]quinolizine
7aH-benzo[a]quinolizine (PubChem CID 57313595) has the molecular formula C13H11N
and a molecular weight of 181.24 g/mol. Its IUPAC name is 7aH-benzo[a]quinolizine.
Molecular Properties
| Compound Name | 7aH-benzo[a]quinolizine |
| PubChem CID | 57313595 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 7aH-benzo[a]quinolizine |
| SMILES | C1=CC2=C3C=CC=CN3C=CC2C=C1 |
| InChI | InChI=1S/C13H11N/c1-2-6-12-11(5-1)8-10-14-9-4-3-7-13(12)14/h1-11H |
| InChIKey | VSYHVPUUTAWQEI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7aH-benzo[a]quinolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7aH-benzo[a]quinolizine?
The IUPAC name of 7aH-benzo[a]quinolizine (CID 57313595) is 7aH-benzo[a]quinolizine.
What is the SMILES notation for 7aH-benzo[a]quinolizine?
The canonical SMILES for 7aH-benzo[a]quinolizine is C1=CC2=C3C=CC=CN3C=CC2C=C1.
What is the InChIKey of 7aH-benzo[a]quinolizine?
The InChIKey is VSYHVPUUTAWQEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N/c1-2-6-12-11(5-1)8-10-14-9-4-3-7-13(12)14/h1-11H.
What are the key properties of 7aH-benzo[a]quinolizine?
7aH-benzo[a]quinolizine has a molecular weight of 181.24 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7aH-benzo[a]quinolizine is sourced from PubChem (CID 57313595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).