About (4-phenylcyclohexyl) carbonochloridate
(4-phenylcyclohexyl) carbonochloridate (PubChem CID 57313775) has the molecular formula C13H15ClO2
and a molecular weight of 238.71 g/mol. Its IUPAC name is (4-phenylcyclohexyl) carbonochloridate.
Molecular Properties
| Compound Name | (4-phenylcyclohexyl) carbonochloridate |
| PubChem CID | 57313775 |
| Molecular Formula | C13H15ClO2 |
| Molecular Weight | 238.71 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (4-phenylcyclohexyl) carbonochloridate |
| SMILES | O=C(Cl)OC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C13H15ClO2/c14-13(15)16-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-5,11-12H,6-9H2 |
| InChIKey | MYFBFKVMIPEFHO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.71 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (4-phenylcyclohexyl) carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylcyclohexyl) carbonochloridate?
The IUPAC name of (4-phenylcyclohexyl) carbonochloridate (CID 57313775) is (4-phenylcyclohexyl) carbonochloridate.
What is the SMILES notation for (4-phenylcyclohexyl) carbonochloridate?
The canonical SMILES for (4-phenylcyclohexyl) carbonochloridate is O=C(Cl)OC1CCC(c2ccccc2)CC1.
What is the InChIKey of (4-phenylcyclohexyl) carbonochloridate?
The InChIKey is MYFBFKVMIPEFHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClO2/c14-13(15)16-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-5,11-12H,6-9H2.
What are the key properties of (4-phenylcyclohexyl) carbonochloridate?
(4-phenylcyclohexyl) carbonochloridate has a molecular weight of 238.71 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylcyclohexyl) carbonochloridate is sourced from PubChem (CID 57313775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).