C9H10N2O — CID 57313870
6-imino-3,7,8,8a-tetrahydroisoquinolin-5-one (PubChem CID 57313870) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 6-imino-3,7,8,8a-tetrahydroisoquinolin-5-one.
| Compound Name | 6-imino-3,7,8,8a-tetrahydroisoquinolin-5-one |
|---|---|
| PubChem CID | 57313870 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 6-imino-3,7,8,8a-tetrahydroisoquinolin-5-one |
| SMILES | [H]/N=C1\CCC2C=NCC=C2C1=O |
| InChI | InChI=1S/C9H10N2O/c10-8-2-1-6-5-11-4-3-7(6)9(8)12/h3,5-6,10H,1-2,4H2/b10-8+ |
| InChIKey | VRAFAJGDLYLDBC-CSKARUKUSA-N |
| XLogP | 1.00 |
| TPSA | 53.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|