C20H26FNO5 — CID 57314141
5-ethyl-4-(4-fluorophenyl)-1,3-dimethyl-2-oxo-6-propan-2-ylpiperidine-3,5-dicarboxylic acid (PubChem CID 57314141) has the molecular formula C20H26FNO5 and a molecular weight of 379.43 g/mol. Its IUPAC name is 5-ethyl-4-(4-fluorophenyl)-1,3-dimethyl-2-oxo-6-propan-2-ylpiperidine-3,5-dicarboxylic acid.
| Compound Name | 5-ethyl-4-(4-fluorophenyl)-1,3-dimethyl-2-oxo-6-propan-2-ylpiperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 57314141 |
| Molecular Formula | C20H26FNO5 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 5-ethyl-4-(4-fluorophenyl)-1,3-dimethyl-2-oxo-6-propan-2-ylpiperidine-3,5-dicarboxylic acid |
| SMILES | CCC1(C(=O)O)C(C(C)C)N(C)C(=O)C(C)(C(=O)O)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H26FNO5/c1-6-20(18(26)27)14(12-7-9-13(21)10-8-12)19(4,17(24)25)16(23)22(5)15(20)11(2)3/h7-11,14-15H,6H2,1-5H3,(H,24,25)(H,26,27) |
| InChIKey | SSUAVKAOHQYXIF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|