C15H20N3O6P — CID 57314937
(2S,3S)-N-dimethoxyphosphoryl-2-methyl-4-oxo-3-[(2-phenylacetyl)amino]azetidine-1-carboxamide (PubChem CID 57314937) has the molecular formula C15H20N3O6P and a molecular weight of 369.31 g/mol. Its IUPAC name is (2S,3S)-N-dimethoxyphosphoryl-2-methyl-4-oxo-3-[(2-phenylacetyl)amino]azetidine-1-carboxamide.
| Compound Name | (2S,3S)-N-dimethoxyphosphoryl-2-methyl-4-oxo-3-[(2-phenylacetyl)amino]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 57314937 |
| Molecular Formula | C15H20N3O6P |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (2S,3S)-N-dimethoxyphosphoryl-2-methyl-4-oxo-3-[(2-phenylacetyl)amino]azetidine-1-carboxamide |
| SMILES | COP(=O)(NC(=O)N1C(=O)[C@@H](NC(=O)Cc2ccccc2)[C@@H]1C)OC |
| InChI | InChI=1S/C15H20N3O6P/c1-10-13(16-12(19)9-11-7-5-4-6-8-11)14(20)18(10)15(21)17-25(22,23-2)24-3/h4-8,10,13H,9H2,1-3H3,(H,16,19)(H,17,21,22)/t10-,13-/m0/s1 |
| InChIKey | JORXWQPJEGQRNP-GWCFXTLKSA-N |
| XLogP | 1.06 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|