C11H9N3 — CID 57315050
2H-pyrazino[2,3-b]quinolizine (PubChem CID 57315050) has the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 2H-pyrazino[2,3-b]quinolizine.
| Compound Name | 2H-pyrazino[2,3-b]quinolizine |
|---|---|
| PubChem CID | 57315050 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 2H-pyrazino[2,3-b]quinolizine |
| SMILES | C1=CC2=CC3=NCC=NC3=CN2C=C1 |
| InChI | InChI=1S/C11H9N3/c1-2-6-14-8-11-10(7-9(14)3-1)12-4-5-13-11/h1-3,5-8H,4H2 |
| InChIKey | MEAWYXFVCBSVAS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |