About ethyl 3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-6-carboxylate
ethyl 3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-6-carboxylate (PubChem CID 57315388) has the molecular formula C26H30N2O2
and a molecular weight of 402.54 g/mol. Its IUPAC name is ethyl 3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-6-carboxylate |
| PubChem CID | 57315388 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | ethyl 3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(CCCCN3CC=C(c4ccccc4)CC3)c[nH]c2c1 |
| InChI | InChI=1S/C26H30N2O2/c1-2-30-26(29)22-11-12-24-23(19-27-25(24)18-22)10-6-7-15-28-16-13-21(14-17-28)20-8-4-3-5-9-20/h3-5,8-9,11-13,18-19,27H,2,6-7,10,14-17H2,1H3 |
| InChIKey | HEKMVJYYSIXPQW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-6-carboxylate?
The IUPAC name of ethyl 3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-6-carboxylate (CID 57315388) is ethyl 3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-6-carboxylate.
What is the SMILES notation for ethyl 3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-6-carboxylate?
The canonical SMILES for ethyl 3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-6-carboxylate is CCOC(=O)c1ccc2c(CCCCN3CC=C(c4ccccc4)CC3)c[nH]c2c1.
What is the InChIKey of ethyl 3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-6-carboxylate?
The InChIKey is HEKMVJYYSIXPQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30N2O2/c1-2-30-26(29)22-11-12-24-23(19-27-25(24)18-22)10-6-7-15-28-16-13-21(14-17-28)20-8-4-3-5-9-20/h3-5,8-9,11-13,18-19,27H,2,6-7,10,14-17H2,1H3.
What are the key properties of ethyl 3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-6-carboxylate?
ethyl 3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-6-carboxylate has a molecular weight of 402.54 g/mol, XLogP of 5.46, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-6-carboxylate is sourced from PubChem (CID 57315388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).