About 1,1-dimethyl-2H-siline
1,1-dimethyl-2H-siline (PubChem CID 573159) has the molecular formula C7H12Si
and a molecular weight of 124.26 g/mol. Its IUPAC name is 1,1-dimethyl-2H-siline.
Molecular Properties
| Compound Name | 1,1-dimethyl-2H-siline |
| PubChem CID | 573159 |
| Molecular Formula | C7H12Si |
| Molecular Weight | 124.26 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | 1,1-dimethyl-2H-siline |
| SMILES | C[Si]1(C)C=CC=CC1 |
| InChI | InChI=1S/C7H12Si/c1-8(2)6-4-3-5-7-8/h3-6H,7H2,1-2H3 |
| InChIKey | SBFJKEVRRVWVLN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethyl-2H-siline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-2H-siline?
The IUPAC name of 1,1-dimethyl-2H-siline (CID 573159) is 1,1-dimethyl-2H-siline.
What is the SMILES notation for 1,1-dimethyl-2H-siline?
The canonical SMILES for 1,1-dimethyl-2H-siline is C[Si]1(C)C=CC=CC1.
What is the InChIKey of 1,1-dimethyl-2H-siline?
The InChIKey is SBFJKEVRRVWVLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12Si/c1-8(2)6-4-3-5-7-8/h3-6H,7H2,1-2H3.
What are the key properties of 1,1-dimethyl-2H-siline?
1,1-dimethyl-2H-siline has a molecular weight of 124.26 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-2H-siline is sourced from PubChem (CID 573159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).