About methoxyiminomethyl 2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]acetate
methoxyiminomethyl 2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]acetate (PubChem CID 57315936) has the molecular formula C15H15F3N2O3S
and a molecular weight of 360.36 g/mol. Its IUPAC name is methoxyiminomethyl 2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]acetate.
Molecular Properties
| Compound Name | methoxyiminomethyl 2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]acetate |
| PubChem CID | 57315936 |
| Molecular Formula | C15H15F3N2O3S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | methoxyiminomethyl 2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]acetate |
| SMILES | CON=COC(=O)CC1=CN(c2ccc(C(F)(F)F)cc2C)CS1 |
| InChI | InChI=1S/C15H15F3N2O3S/c1-10-5-11(15(16,17)18)3-4-13(10)20-7-12(24-9-20)6-14(21)23-8-19-22-2/h3-5,7-8H,6,9H2,1-2H3 |
| InChIKey | IVHZVUZFMZMKAT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methoxyiminomethyl 2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxyiminomethyl 2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]acetate?
The IUPAC name of methoxyiminomethyl 2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]acetate (CID 57315936) is methoxyiminomethyl 2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]acetate.
What is the SMILES notation for methoxyiminomethyl 2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]acetate?
The canonical SMILES for methoxyiminomethyl 2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]acetate is CON=COC(=O)CC1=CN(c2ccc(C(F)(F)F)cc2C)CS1.
What is the InChIKey of methoxyiminomethyl 2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]acetate?
The InChIKey is IVHZVUZFMZMKAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F3N2O3S/c1-10-5-11(15(16,17)18)3-4-13(10)20-7-12(24-9-20)6-14(21)23-8-19-22-2/h3-5,7-8H,6,9H2,1-2H3.
What are the key properties of methoxyiminomethyl 2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]acetate?
methoxyiminomethyl 2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]acetate has a molecular weight of 360.36 g/mol, XLogP of 3.89, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methoxyiminomethyl 2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]acetate is sourced from PubChem (CID 57315936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).