About 4-Acetoxy-tempo
4-Acetoxy-tempo (PubChem CID 573160) has the molecular formula C11H20NO3
and a molecular weight of 214.28 g/mol.
Molecular Properties
| Compound Name | 4-Acetoxy-tempo |
| PubChem CID | 573160 |
| Molecular Formula | C11H20NO3 |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | — |
| SMILES | CC(=O)OC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C11H20NO3/c1-8(13)15-9-6-10(2,3)12(14)11(4,5)7-9/h9H,6-7H2,1-5H3 |
| InChIKey | KDMUXDXMUIHIGX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-Acetoxy-tempo with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Acetoxy-tempo?
The IUPAC name of 4-Acetoxy-tempo (CID 573160) is not available.
What is the SMILES notation for 4-Acetoxy-tempo?
The canonical SMILES for 4-Acetoxy-tempo is CC(=O)OC1CC(C)(C)N([O])C(C)(C)C1.
What is the InChIKey of 4-Acetoxy-tempo?
The InChIKey is KDMUXDXMUIHIGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20NO3/c1-8(13)15-9-6-10(2,3)12(14)11(4,5)7-9/h9H,6-7H2,1-5H3.
What are the key properties of 4-Acetoxy-tempo?
4-Acetoxy-tempo has a molecular weight of 214.28 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Acetoxy-tempo is sourced from PubChem (CID 573160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).