C20H17N6O+ — CID 57316601
3-diazonioimino-6-[[2-[[4-(iminohydrazinylidene)cyclohexa-2,5-dien-1-ylidene]methyl]-3-oxocyclohexen-1-yl]methylidene]cyclohexa-1,4-diene (PubChem CID 57316601) has the molecular formula C20H17N6O+ and a molecular weight of 357.40 g/mol. Its IUPAC name is 3-diazonioimino-6-[[2-[[4-(iminohydrazinylidene)cyclohexa-2,5-dien-1-ylidene]methyl]-3-oxocyclohexen-1-yl]methylidene]cyclohexa-1,4-diene.
| Compound Name | 3-diazonioimino-6-[[2-[[4-(iminohydrazinylidene)cyclohexa-2,5-dien-1-ylidene]methyl]-3-oxocyclohexen-1-yl]methylidene]cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 57316601 |
| Molecular Formula | C20H17N6O+ |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-diazonioimino-6-[[2-[[4-(iminohydrazinylidene)cyclohexa-2,5-dien-1-ylidene]methyl]-3-oxocyclohexen-1-yl]methylidene]cyclohexa-1,4-diene |
| SMILES | [H]/N=N/N=C1C=CC(=CC2=C(C=C3C=CC(=N[N+]#N)C=C3)CCCC2=O)C=C1 |
| InChI | InChI=1S/C20H17N6O/c21-25-23-17-8-4-14(5-9-17)12-16-2-1-3-20(27)19(16)13-15-6-10-18(11-7-15)24-26-22/h4-13,22H,1-3H2/q+1/b14-12-,15-13-,23-17+,24-18+,26-22+ |
| InChIKey | QTCKJBDBCSANJD-KSDZPFOVSA-N |
| XLogP | 4.74 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|