About 1-chlorooctane-1-thiol
1-chlorooctane-1-thiol (PubChem CID 57316729) has the molecular formula C8H17ClS
and a molecular weight of 180.74 g/mol. Its IUPAC name is 1-chlorooctane-1-thiol.
Molecular Properties
| Compound Name | 1-chlorooctane-1-thiol |
| PubChem CID | 57316729 |
| Molecular Formula | C8H17ClS |
| Molecular Weight | 180.74 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 1-chlorooctane-1-thiol |
| SMILES | CCCCCCCC(S)Cl |
| InChI | InChI=1S/C8H17ClS/c1-2-3-4-5-6-7-8(9)10/h8,10H,2-7H2,1H3 |
| InChIKey | KIXYRJPNFPNIIA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.74 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-chlorooctane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chlorooctane-1-thiol?
The IUPAC name of 1-chlorooctane-1-thiol (CID 57316729) is 1-chlorooctane-1-thiol.
What is the SMILES notation for 1-chlorooctane-1-thiol?
The canonical SMILES for 1-chlorooctane-1-thiol is CCCCCCCC(S)Cl.
What is the InChIKey of 1-chlorooctane-1-thiol?
The InChIKey is KIXYRJPNFPNIIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17ClS/c1-2-3-4-5-6-7-8(9)10/h8,10H,2-7H2,1H3.
What are the key properties of 1-chlorooctane-1-thiol?
1-chlorooctane-1-thiol has a molecular weight of 180.74 g/mol, XLogP of 3.84, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chlorooctane-1-thiol is sourced from PubChem (CID 57316729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).