C21H22ClNO3S — CID 57317228
2-[4-[(6-chloro-1,3-benzothiazol-2-yl)oxy]phenoxy]-3-ethylhexanal (PubChem CID 57317228) has the molecular formula C21H22ClNO3S and a molecular weight of 403.93 g/mol. Its IUPAC name is 2-[4-[(6-chloro-1,3-benzothiazol-2-yl)oxy]phenoxy]-3-ethylhexanal.
| Compound Name | 2-[4-[(6-chloro-1,3-benzothiazol-2-yl)oxy]phenoxy]-3-ethylhexanal |
|---|---|
| PubChem CID | 57317228 |
| Molecular Formula | C21H22ClNO3S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 2-[4-[(6-chloro-1,3-benzothiazol-2-yl)oxy]phenoxy]-3-ethylhexanal |
| SMILES | CCCC(CC)C(C=O)Oc1ccc(Oc2nc3ccc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C21H22ClNO3S/c1-3-5-14(4-2)19(13-24)25-16-7-9-17(10-8-16)26-21-23-18-11-6-15(22)12-20(18)27-21/h6-14,19H,3-5H2,1-2H3 |
| InChIKey | LKZLVKQSVYBXJP-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|