C36H70O4Si2 — CID 57317322
7-[(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylcyclopenten-1-yl]-2-methylheptanoic acid (PubChem CID 57317322) has the molecular formula C36H70O4Si2 and a molecular weight of 623.12 g/mol. Its IUPAC name is 7-[(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylcyclopenten-1-yl]-2-methylheptanoic acid.
| Compound Name | 7-[(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylcyclopenten-1-yl]-2-methylheptanoic acid |
|---|---|
| PubChem CID | 57317322 |
| Molecular Formula | C36H70O4Si2 |
| Molecular Weight | 623.12 g/mol |
| Exact Mass | 622.48 |
| IUPAC Name | 7-[(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylcyclopenten-1-yl]-2-methylheptanoic acid |
| SMILES | CCCC[C@@H](C)C[C@@H](C=C[C@@H]1C(CCCCCC(C)C(=O)O)=C(C)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H70O4Si2/c1-15-16-20-27(2)25-30(39-41(11,12)35(5,6)7)23-24-32-31(22-19-17-18-21-28(3)34(37)38)29(4)26-33(32)40-42(13,14)36(8,9)10/h23-24,27-28,30,32-33H,15-22,25-26H2,1-14H3,(H,37,38)/t27-,28?,30-,32-,33-/m1/s1 |
| InChIKey | WNVFBENMVPIPKJ-MAPIUEGSSA-N |
| XLogP | 11.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.12 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|