C25H32NO8S2+ — CID 57317345
(1S,4R)-4-hydroxy-1-[3-[(4-methoxyphenyl)methylsulfanyl]-2-methylpropanoyl]-2-methyl-4-(4-methylphenyl)sulfonyloxypyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57317345) has the molecular formula C25H32NO8S2+ and a molecular weight of 538.66 g/mol. Its IUPAC name is (1S,4R)-4-hydroxy-1-[3-[(4-methoxyphenyl)methylsulfanyl]-2-methylpropanoyl]-2-methyl-4-(4-methylphenyl)sulfonyloxypyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1S,4R)-4-hydroxy-1-[3-[(4-methoxyphenyl)methylsulfanyl]-2-methylpropanoyl]-2-methyl-4-(4-methylphenyl)sulfonyloxypyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57317345 |
| Molecular Formula | C25H32NO8S2+ |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | (1S,4R)-4-hydroxy-1-[3-[(4-methoxyphenyl)methylsulfanyl]-2-methylpropanoyl]-2-methyl-4-(4-methylphenyl)sulfonyloxypyrrolidin-1-ium-1-carboxylic acid |
| SMILES | COc1ccc(CSCC(C)C(=O)[N@+]2(C(=O)O)C[C@](O)(OS(=O)(=O)c3ccc(C)cc3)CC2C)cc1 |
| InChI | InChI=1S/C25H31NO8S2/c1-17-5-11-22(12-6-17)36(31,32)34-25(30)13-19(3)26(16-25,24(28)29)23(27)18(2)14-35-15-20-7-9-21(33-4)10-8-20/h5-12,18-19,30H,13-16H2,1-4H3/p+1/t18?,19?,25-,26+/m1/s1 |
| InChIKey | KCRYMRSVTCHONP-GTDXGSHGSA-O |
| XLogP | 3.78 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|