C11H9F6NO — CID 57317397
1-[2,4-bis(trifluoromethyl)phenyl]-N-methoxyethenamine (PubChem CID 57317397) has the molecular formula C11H9F6NO and a molecular weight of 285.19 g/mol. Its IUPAC name is 1-[2,4-bis(trifluoromethyl)phenyl]-N-methoxyethenamine.
| Compound Name | 1-[2,4-bis(trifluoromethyl)phenyl]-N-methoxyethenamine |
|---|---|
| PubChem CID | 57317397 |
| Molecular Formula | C11H9F6NO |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-[2,4-bis(trifluoromethyl)phenyl]-N-methoxyethenamine |
| SMILES | C=C(NOC)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C11H9F6NO/c1-6(18-19-2)8-4-3-7(10(12,13)14)5-9(8)11(15,16)17/h3-5,18H,1H2,2H3 |
| InChIKey | CLRAQRJVUNJVLL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|