C26H33NO4S3 — CID 57317409
tert-butyl 5-[5-benzylsulfanyl-3-methylsulfonyl-3-(1H-pyrrol-2-yl)pentyl]thiophene-2-carboxylate (PubChem CID 57317409) has the molecular formula C26H33NO4S3 and a molecular weight of 519.75 g/mol. Its IUPAC name is tert-butyl 5-[5-benzylsulfanyl-3-methylsulfonyl-3-(1H-pyrrol-2-yl)pentyl]thiophene-2-carboxylate.
| Compound Name | tert-butyl 5-[5-benzylsulfanyl-3-methylsulfonyl-3-(1H-pyrrol-2-yl)pentyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 57317409 |
| Molecular Formula | C26H33NO4S3 |
| Molecular Weight | 519.75 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | tert-butyl 5-[5-benzylsulfanyl-3-methylsulfonyl-3-(1H-pyrrol-2-yl)pentyl]thiophene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc(CCC(CCSCc2ccccc2)(c2ccc[nH]2)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C26H33NO4S3/c1-25(2,3)31-24(28)22-13-12-21(33-22)14-15-26(34(4,29)30,23-11-8-17-27-23)16-18-32-19-20-9-6-5-7-10-20/h5-13,17,27H,14-16,18-19H2,1-4H3 |
| InChIKey | WWSOYMWXVDPCTQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.75 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|