C19H15N3O3 — CID 57317859
5-(furan-2-yl)-3-[[3-(hydroxymethyl)phenyl]iminomethyl]-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (PubChem CID 57317859) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 5-(furan-2-yl)-3-[[3-(hydroxymethyl)phenyl]iminomethyl]-1,3-dihydropyrrolo[2,3-b]pyridin-2-one.
| Compound Name | 5-(furan-2-yl)-3-[[3-(hydroxymethyl)phenyl]iminomethyl]-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 57317859 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 5-(furan-2-yl)-3-[[3-(hydroxymethyl)phenyl]iminomethyl]-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| SMILES | O=C1Nc2ncc(-c3ccco3)cc2C1/C=N/c1cccc(CO)c1 |
| InChI | InChI=1S/C19H15N3O3/c23-11-12-3-1-4-14(7-12)20-10-16-15-8-13(17-5-2-6-25-17)9-21-18(15)22-19(16)24/h1-10,16,23H,11H2,(H,21,22,24)/b20-10+ |
| InChIKey | OURJVQCPOHSRQX-KEBDBYFISA-N |
| XLogP | 3.27 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|